C19H17Cl2N3O6 — CID 55926082
[1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] (2S)-2-[(2-chlorobenzoyl)amino]propanoate (PubChem CID 55926082) has the molecular formula C19H17Cl2N3O6 and a molecular weight of 454.27 g/mol. Its IUPAC name is [1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] (2S)-2-[(2-chlorobenzoyl)amino]propanoate.
| Compound Name | [1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] (2S)-2-[(2-chlorobenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 55926082 |
| Molecular Formula | C19H17Cl2N3O6 |
| Molecular Weight | 454.27 g/mol |
| Exact Mass | 453.05 |
| IUPAC Name | [1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] (2S)-2-[(2-chlorobenzoyl)amino]propanoate |
| SMILES | CC(OC(=O)[C@H](C)NC(=O)c1ccccc1Cl)C(=O)Nc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C19H17Cl2N3O6/c1-10(22-18(26)13-5-3-4-6-14(13)20)19(27)30-11(2)17(25)23-16-8-7-12(24(28)29)9-15(16)21/h3-11H,1-2H3,(H,22,26)(H,23,25)/t10-,11?/m0/s1 |
| InChIKey | ZXVGGERLXDMTEF-VUWPPUDQSA-N |
| XLogP | 3.59 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.27 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|