C14H15ClN2O5 — CID 42044882
[(2S)-1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 3-methylbut-2-enoate (PubChem CID 42044882) has the molecular formula C14H15ClN2O5 and a molecular weight of 326.74 g/mol. Its IUPAC name is [(2S)-1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 3-methylbut-2-enoate.
| Compound Name | [(2S)-1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 42044882 |
| Molecular Formula | C14H15ClN2O5 |
| Molecular Weight | 326.74 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | [(2S)-1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 3-methylbut-2-enoate |
| SMILES | CC(C)=CC(=O)O[C@@H](C)C(=O)Nc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C14H15ClN2O5/c1-8(2)6-13(18)22-9(3)14(19)16-12-5-4-10(17(20)21)7-11(12)15/h4-7,9H,1-3H3,(H,16,19)/t9-/m0/s1 |
| InChIKey | BBSMDAKTSHJOKO-VIFPVBQESA-N |
| XLogP | 3.08 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.74 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|