C15H9Cl4N3O5 — CID 16958541
[1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 3,4,5-trichloropyridine-2-carboxylate (PubChem CID 16958541) has the molecular formula C15H9Cl4N3O5 and a molecular weight of 453.07 g/mol. Its IUPAC name is [1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 3,4,5-trichloropyridine-2-carboxylate.
| Compound Name | [1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 3,4,5-trichloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 16958541 |
| Molecular Formula | C15H9Cl4N3O5 |
| Molecular Weight | 453.07 g/mol |
| Exact Mass | 450.93 |
| IUPAC Name | [1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 3,4,5-trichloropyridine-2-carboxylate |
| SMILES | CC(OC(=O)c1ncc(Cl)c(Cl)c1Cl)C(=O)Nc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C15H9Cl4N3O5/c1-6(27-15(24)13-12(19)11(18)9(17)5-20-13)14(23)21-10-3-2-7(22(25)26)4-8(10)16/h2-6H,1H3,(H,21,23) |
| InChIKey | BIRFBEAROGDTTB-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.07 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|