C15H14ClN3O5S — CID 41380552
[(2S)-1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 2,4-dimethyl-1,3-thiazole-5-carboxylate (PubChem CID 41380552) has the molecular formula C15H14ClN3O5S and a molecular weight of 383.81 g/mol. Its IUPAC name is [(2S)-1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 2,4-dimethyl-1,3-thiazole-5-carboxylate.
| Compound Name | [(2S)-1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 2,4-dimethyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 41380552 |
| Molecular Formula | C15H14ClN3O5S |
| Molecular Weight | 383.81 g/mol |
| Exact Mass | 383.03 |
| IUPAC Name | [(2S)-1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 2,4-dimethyl-1,3-thiazole-5-carboxylate |
| SMILES | Cc1nc(C)c(C(=O)O[C@@H](C)C(=O)Nc2ccc([N+](=O)[O-])cc2Cl)s1 |
| InChI | InChI=1S/C15H14ClN3O5S/c1-7-13(25-9(3)17-7)15(21)24-8(2)14(20)18-12-5-4-10(19(22)23)6-11(12)16/h4-6,8H,1-3H3,(H,18,20)/t8-/m0/s1 |
| InChIKey | FZGMMBFSQSUIOT-QMMMGPOBSA-N |
| XLogP | 3.51 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.81 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|