C16H17N3O6S — CID 7954464
[(2S)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] 2,4-dimethyl-1,3-thiazole-5-carboxylate (PubChem CID 7954464) has the molecular formula C16H17N3O6S and a molecular weight of 379.39 g/mol. Its IUPAC name is [(2S)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] 2,4-dimethyl-1,3-thiazole-5-carboxylate.
| Compound Name | [(2S)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] 2,4-dimethyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 7954464 |
| Molecular Formula | C16H17N3O6S |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | [(2S)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] 2,4-dimethyl-1,3-thiazole-5-carboxylate |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)[C@H](C)OC(=O)c1sc(C)nc1C |
| InChI | InChI=1S/C16H17N3O6S/c1-8-14(26-10(3)17-8)16(21)25-9(2)15(20)18-12-7-11(19(22)23)5-6-13(12)24-4/h5-7,9H,1-4H3,(H,18,20)/t9-/m0/s1 |
| InChIKey | JDUQULVDTQSZFC-VIFPVBQESA-N |
| XLogP | 2.86 |
| TPSA | 120.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|