C18H18ClN3O6 — CID 8510728
[(2S)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] 2-chloro-4,6-dimethylpyridine-3-carboxylate (PubChem CID 8510728) has the molecular formula C18H18ClN3O6 and a molecular weight of 407.81 g/mol. Its IUPAC name is [(2S)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] 2-chloro-4,6-dimethylpyridine-3-carboxylate.
| Compound Name | [(2S)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] 2-chloro-4,6-dimethylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 8510728 |
| Molecular Formula | C18H18ClN3O6 |
| Molecular Weight | 407.81 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | [(2S)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] 2-chloro-4,6-dimethylpyridine-3-carboxylate |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)[C@H](C)OC(=O)c1c(C)cc(C)nc1Cl |
| InChI | InChI=1S/C18H18ClN3O6/c1-9-7-10(2)20-16(19)15(9)18(24)28-11(3)17(23)21-13-8-12(22(25)26)5-6-14(13)27-4/h5-8,11H,1-4H3,(H,21,23)/t11-/m0/s1 |
| InChIKey | BUKISADBVREHSX-NSHDSACASA-N |
| XLogP | 3.45 |
| TPSA | 120.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.81 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|