C22H17ClN4O5S — CID 25398753
[(2S)-1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carboxylate (PubChem CID 25398753) has the molecular formula C22H17ClN4O5S and a molecular weight of 484.92 g/mol. Its IUPAC name is [(2S)-1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carboxylate.
| Compound Name | [(2S)-1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 25398753 |
| Molecular Formula | C22H17ClN4O5S |
| Molecular Weight | 484.92 g/mol |
| Exact Mass | 484.06 |
| IUPAC Name | [(2S)-1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carboxylate |
| SMILES | Cc1nn(-c2ccccc2)c2sc(C(=O)O[C@@H](C)C(=O)Nc3ccc([N+](=O)[O-])cc3Cl)cc12 |
| InChI | InChI=1S/C22H17ClN4O5S/c1-12-16-11-19(33-21(16)26(25-12)14-6-4-3-5-7-14)22(29)32-13(2)20(28)24-18-9-8-15(27(30)31)10-17(18)23/h3-11,13H,1-2H3,(H,24,28)/t13-/m0/s1 |
| InChIKey | HQYRLSDLOFGMRD-ZDUSSCGKSA-N |
| XLogP | 5.14 |
| TPSA | 116.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.92 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|