C18H15Cl3N2O6 — CID 23958969
[1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 2-(2,4-dichlorophenoxy)propanoate (PubChem CID 23958969) has the molecular formula C18H15Cl3N2O6 and a molecular weight of 461.69 g/mol. Its IUPAC name is [1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 2-(2,4-dichlorophenoxy)propanoate.
| Compound Name | [1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 2-(2,4-dichlorophenoxy)propanoate |
|---|---|
| PubChem CID | 23958969 |
| Molecular Formula | C18H15Cl3N2O6 |
| Molecular Weight | 461.69 g/mol |
| Exact Mass | 460.00 |
| IUPAC Name | [1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 2-(2,4-dichlorophenoxy)propanoate |
| SMILES | CC(OC(=O)C(C)Oc1ccc(Cl)cc1Cl)C(=O)Nc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C18H15Cl3N2O6/c1-9(17(24)22-15-5-4-12(23(26)27)8-13(15)20)29-18(25)10(2)28-16-6-3-11(19)7-14(16)21/h3-10H,1-2H3,(H,22,24) |
| InChIKey | GDBYTSINVOSZIF-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.69 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|