C23H16ClF4N3O7S — CID 98393706
[(2S)-1-[4-nitro-2-(trifluoromethyl)anilino]-1-oxopropan-2-yl] 2-chloro-5-[(2-fluorophenyl)sulfamoyl]benzoate (PubChem CID 98393706) has the molecular formula C23H16ClF4N3O7S and a molecular weight of 589.91 g/mol. Its IUPAC name is [(2S)-1-[4-nitro-2-(trifluoromethyl)anilino]-1-oxopropan-2-yl] 2-chloro-5-[(2-fluorophenyl)sulfamoyl]benzoate.
| Compound Name | [(2S)-1-[4-nitro-2-(trifluoromethyl)anilino]-1-oxopropan-2-yl] 2-chloro-5-[(2-fluorophenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 98393706 |
| Molecular Formula | C23H16ClF4N3O7S |
| Molecular Weight | 589.91 g/mol |
| Exact Mass | 589.03 |
| IUPAC Name | [(2S)-1-[4-nitro-2-(trifluoromethyl)anilino]-1-oxopropan-2-yl] 2-chloro-5-[(2-fluorophenyl)sulfamoyl]benzoate |
| SMILES | C[C@H](OC(=O)c1cc(S(=O)(=O)Nc2ccccc2F)ccc1Cl)C(=O)Nc1ccc([N+](=O)[O-])cc1C(F)(F)F |
| InChI | InChI=1S/C23H16ClF4N3O7S/c1-12(21(32)29-19-9-6-13(31(34)35)10-16(19)23(26,27)28)38-22(33)15-11-14(7-8-17(15)24)39(36,37)30-20-5-3-2-4-18(20)25/h2-12,30H,1H3,(H,29,32)/t12-/m0/s1 |
| InChIKey | GJHRPFWEXAZYED-LBPRGKRZSA-N |
| XLogP | 5.39 |
| TPSA | 144.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.91 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|