C16H10Cl2F3N3O5 — CID 5024646
[1-[4-nitro-2-(trifluoromethyl)anilino]-1-oxopropan-2-yl] 5,6-dichloropyridine-3-carboxylate (PubChem CID 5024646) has the molecular formula C16H10Cl2F3N3O5 and a molecular weight of 452.17 g/mol. Its IUPAC name is [1-[4-nitro-2-(trifluoromethyl)anilino]-1-oxopropan-2-yl] 5,6-dichloropyridine-3-carboxylate.
| Compound Name | [1-[4-nitro-2-(trifluoromethyl)anilino]-1-oxopropan-2-yl] 5,6-dichloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 5024646 |
| Molecular Formula | C16H10Cl2F3N3O5 |
| Molecular Weight | 452.17 g/mol |
| Exact Mass | 450.99 |
| IUPAC Name | [1-[4-nitro-2-(trifluoromethyl)anilino]-1-oxopropan-2-yl] 5,6-dichloropyridine-3-carboxylate |
| SMILES | CC(OC(=O)c1cnc(Cl)c(Cl)c1)C(=O)Nc1ccc([N+](=O)[O-])cc1C(F)(F)F |
| InChI | InChI=1S/C16H10Cl2F3N3O5/c1-7(29-15(26)8-4-11(17)13(18)22-6-8)14(25)23-12-3-2-9(24(27)28)5-10(12)16(19,20)21/h2-7H,1H3,(H,23,25) |
| InChIKey | ZYWOVKQKKBKGHW-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.17 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|