C22H19F3N4O6 — CID 41094039
[(2R)-1-[4-nitro-2-(trifluoromethyl)anilino]-1-oxopropan-2-yl] 4-oxo-3-propan-2-ylphthalazine-1-carboxylate (PubChem CID 41094039) has the molecular formula C22H19F3N4O6 and a molecular weight of 492.41 g/mol. Its IUPAC name is [(2R)-1-[4-nitro-2-(trifluoromethyl)anilino]-1-oxopropan-2-yl] 4-oxo-3-propan-2-ylphthalazine-1-carboxylate.
| Compound Name | [(2R)-1-[4-nitro-2-(trifluoromethyl)anilino]-1-oxopropan-2-yl] 4-oxo-3-propan-2-ylphthalazine-1-carboxylate |
|---|---|
| PubChem CID | 41094039 |
| Molecular Formula | C22H19F3N4O6 |
| Molecular Weight | 492.41 g/mol |
| Exact Mass | 492.13 |
| IUPAC Name | [(2R)-1-[4-nitro-2-(trifluoromethyl)anilino]-1-oxopropan-2-yl] 4-oxo-3-propan-2-ylphthalazine-1-carboxylate |
| SMILES | CC(C)n1nc(C(=O)O[C@H](C)C(=O)Nc2ccc([N+](=O)[O-])cc2C(F)(F)F)c2ccccc2c1=O |
| InChI | InChI=1S/C22H19F3N4O6/c1-11(2)28-20(31)15-7-5-4-6-14(15)18(27-28)21(32)35-12(3)19(30)26-17-9-8-13(29(33)34)10-16(17)22(23,24)25/h4-12H,1-3H3,(H,26,30)/t12-/m1/s1 |
| InChIKey | XFSHAPKRNKCBQA-GFCCVEGCSA-N |
| XLogP | 4.09 |
| TPSA | 133.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.41 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|