C19H14F3N3O6S — CID 55567738
[1-[4-nitro-2-(trifluoromethyl)anilino]-1-oxopropan-2-yl] 2-(furan-2-yl)-5-methyl-1,3-thiazole-4-carboxylate (PubChem CID 55567738) has the molecular formula C19H14F3N3O6S and a molecular weight of 469.40 g/mol. Its IUPAC name is [1-[4-nitro-2-(trifluoromethyl)anilino]-1-oxopropan-2-yl] 2-(furan-2-yl)-5-methyl-1,3-thiazole-4-carboxylate.
| Compound Name | [1-[4-nitro-2-(trifluoromethyl)anilino]-1-oxopropan-2-yl] 2-(furan-2-yl)-5-methyl-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 55567738 |
| Molecular Formula | C19H14F3N3O6S |
| Molecular Weight | 469.40 g/mol |
| Exact Mass | 469.06 |
| IUPAC Name | [1-[4-nitro-2-(trifluoromethyl)anilino]-1-oxopropan-2-yl] 2-(furan-2-yl)-5-methyl-1,3-thiazole-4-carboxylate |
| SMILES | Cc1sc(-c2ccco2)nc1C(=O)OC(C)C(=O)Nc1ccc([N+](=O)[O-])cc1C(F)(F)F |
| InChI | InChI=1S/C19H14F3N3O6S/c1-9(31-18(27)15-10(2)32-17(24-15)14-4-3-7-30-14)16(26)23-13-6-5-11(25(28)29)8-12(13)19(20,21)22/h3-9H,1-2H3,(H,23,26) |
| InChIKey | XQVGJFLYSJBIND-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 124.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.40 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|