C18H15F3N2O7 — CID 55307869
[1-[4-nitro-2-(trifluoromethyl)anilino]-1-oxopropan-2-yl] 2-hydroxy-3-methoxybenzoate (PubChem CID 55307869) has the molecular formula C18H15F3N2O7 and a molecular weight of 428.32 g/mol. Its IUPAC name is [1-[4-nitro-2-(trifluoromethyl)anilino]-1-oxopropan-2-yl] 2-hydroxy-3-methoxybenzoate.
| Compound Name | [1-[4-nitro-2-(trifluoromethyl)anilino]-1-oxopropan-2-yl] 2-hydroxy-3-methoxybenzoate |
|---|---|
| PubChem CID | 55307869 |
| Molecular Formula | C18H15F3N2O7 |
| Molecular Weight | 428.32 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | [1-[4-nitro-2-(trifluoromethyl)anilino]-1-oxopropan-2-yl] 2-hydroxy-3-methoxybenzoate |
| SMILES | COc1cccc(C(=O)OC(C)C(=O)Nc2ccc([N+](=O)[O-])cc2C(F)(F)F)c1O |
| InChI | InChI=1S/C18H15F3N2O7/c1-9(30-17(26)11-4-3-5-14(29-2)15(11)24)16(25)22-13-7-6-10(23(27)28)8-12(13)18(19,20)21/h3-9,24H,1-2H3,(H,22,25) |
| InChIKey | XBXZNZWJTYCLME-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 128.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.32 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|