C18H12F3N3O5 — CID 8018507
[(2R)-1-[4-nitro-2-(trifluoromethyl)anilino]-1-oxopropan-2-yl] 4-cyanobenzoate (PubChem CID 8018507) has the molecular formula C18H12F3N3O5 and a molecular weight of 407.30 g/mol. Its IUPAC name is [(2R)-1-[4-nitro-2-(trifluoromethyl)anilino]-1-oxopropan-2-yl] 4-cyanobenzoate.
| Compound Name | [(2R)-1-[4-nitro-2-(trifluoromethyl)anilino]-1-oxopropan-2-yl] 4-cyanobenzoate |
|---|---|
| PubChem CID | 8018507 |
| Molecular Formula | C18H12F3N3O5 |
| Molecular Weight | 407.30 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | [(2R)-1-[4-nitro-2-(trifluoromethyl)anilino]-1-oxopropan-2-yl] 4-cyanobenzoate |
| SMILES | C[C@@H](OC(=O)c1ccc(C#N)cc1)C(=O)Nc1ccc([N+](=O)[O-])cc1C(F)(F)F |
| InChI | InChI=1S/C18H12F3N3O5/c1-10(29-17(26)12-4-2-11(9-22)3-5-12)16(25)23-15-7-6-13(24(27)28)8-14(15)18(19,20)21/h2-8,10H,1H3,(H,23,25)/t10-/m1/s1 |
| InChIKey | UBCWXBVCSYOUAW-SNVBAGLBSA-N |
| XLogP | 3.67 |
| TPSA | 122.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.30 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|