C24H16F3N3O6 — CID 40984932
[(2R)-1-[4-nitro-2-(trifluoromethyl)anilino]-1-oxopropan-2-yl] 3-phenyl-2,1-benzoxazole-5-carboxylate (PubChem CID 40984932) has the molecular formula C24H16F3N3O6 and a molecular weight of 499.40 g/mol. Its IUPAC name is [(2R)-1-[4-nitro-2-(trifluoromethyl)anilino]-1-oxopropan-2-yl] 3-phenyl-2,1-benzoxazole-5-carboxylate.
| Compound Name | [(2R)-1-[4-nitro-2-(trifluoromethyl)anilino]-1-oxopropan-2-yl] 3-phenyl-2,1-benzoxazole-5-carboxylate |
|---|---|
| PubChem CID | 40984932 |
| Molecular Formula | C24H16F3N3O6 |
| Molecular Weight | 499.40 g/mol |
| Exact Mass | 499.10 |
| IUPAC Name | [(2R)-1-[4-nitro-2-(trifluoromethyl)anilino]-1-oxopropan-2-yl] 3-phenyl-2,1-benzoxazole-5-carboxylate |
| SMILES | C[C@@H](OC(=O)c1ccc2noc(-c3ccccc3)c2c1)C(=O)Nc1ccc([N+](=O)[O-])cc1C(F)(F)F |
| InChI | InChI=1S/C24H16F3N3O6/c1-13(22(31)28-20-10-8-16(30(33)34)12-18(20)24(25,26)27)35-23(32)15-7-9-19-17(11-15)21(36-29-19)14-5-3-2-4-6-14/h2-13H,1H3,(H,28,31)/t13-/m1/s1 |
| InChIKey | OHALFYKBEXUJOA-CYBMUJFWSA-N |
| XLogP | 5.61 |
| TPSA | 124.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.40 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|