C17H12N2O3 — CID 7503366
[(1R)-1-cyanoethyl] 3-phenyl-2,1-benzoxazole-5-carboxylate (PubChem CID 7503366) has the molecular formula C17H12N2O3 and a molecular weight of 292.29 g/mol. Its IUPAC name is [(1R)-1-cyanoethyl] 3-phenyl-2,1-benzoxazole-5-carboxylate.
| Compound Name | [(1R)-1-cyanoethyl] 3-phenyl-2,1-benzoxazole-5-carboxylate |
|---|---|
| PubChem CID | 7503366 |
| Molecular Formula | C17H12N2O3 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | [(1R)-1-cyanoethyl] 3-phenyl-2,1-benzoxazole-5-carboxylate |
| SMILES | C[C@H](C#N)OC(=O)c1ccc2noc(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C17H12N2O3/c1-11(10-18)21-17(20)13-7-8-15-14(9-13)16(22-19-15)12-5-3-2-4-6-12/h2-9,11H,1H3/t11-/m1/s1 |
| InChIKey | GSGULAYWSKDDHW-LLVKDONJSA-N |
| XLogP | 3.56 |
| TPSA | 76.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |