C21H13N3O2 — CID 9192548
N-(3-cyanophenyl)-3-phenyl-2,1-benzoxazole-5-carboxamide (PubChem CID 9192548) has the molecular formula C21H13N3O2 and a molecular weight of 339.35 g/mol. Its IUPAC name is N-(3-cyanophenyl)-3-phenyl-2,1-benzoxazole-5-carboxamide.
| Compound Name | N-(3-cyanophenyl)-3-phenyl-2,1-benzoxazole-5-carboxamide |
|---|---|
| PubChem CID | 9192548 |
| Molecular Formula | C21H13N3O2 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | N-(3-cyanophenyl)-3-phenyl-2,1-benzoxazole-5-carboxamide |
| SMILES | N#Cc1cccc(NC(=O)c2ccc3noc(-c4ccccc4)c3c2)c1 |
| InChI | InChI=1S/C21H13N3O2/c22-13-14-5-4-8-17(11-14)23-21(25)16-9-10-19-18(12-16)20(26-24-19)15-6-2-1-3-7-15/h1-12H,(H,23,25) |
| InChIKey | OPTXXEQXKRSFIF-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |