C23H16N2O2 — CID 24615547
3-phenyl-N-(3-phenylprop-2-ynyl)-2,1-benzoxazole-5-carboxamide (PubChem CID 24615547) has the molecular formula C23H16N2O2 and a molecular weight of 352.39 g/mol. Its IUPAC name is 3-phenyl-N-(3-phenylprop-2-ynyl)-2,1-benzoxazole-5-carboxamide.
| Compound Name | 3-phenyl-N-(3-phenylprop-2-ynyl)-2,1-benzoxazole-5-carboxamide |
|---|---|
| PubChem CID | 24615547 |
| Molecular Formula | C23H16N2O2 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 3-phenyl-N-(3-phenylprop-2-ynyl)-2,1-benzoxazole-5-carboxamide |
| SMILES | O=C(NCC#Cc1ccccc1)c1ccc2noc(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C23H16N2O2/c26-23(24-15-7-10-17-8-3-1-4-9-17)19-13-14-21-20(16-19)22(27-25-21)18-11-5-2-6-12-18/h1-6,8-9,11-14,16H,15H2,(H,24,26) |
| InChIKey | XXXWSNHAGMRMCM-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|