C17H14N2O2 — CID 9210227
N-cyclopropyl-3-phenyl-2,1-benzoxazole-5-carboxamide (PubChem CID 9210227) has the molecular formula C17H14N2O2 and a molecular weight of 278.31 g/mol. Its IUPAC name is N-cyclopropyl-3-phenyl-2,1-benzoxazole-5-carboxamide.
| Compound Name | N-cyclopropyl-3-phenyl-2,1-benzoxazole-5-carboxamide |
|---|---|
| PubChem CID | 9210227 |
| Molecular Formula | C17H14N2O2 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | N-cyclopropyl-3-phenyl-2,1-benzoxazole-5-carboxamide |
| SMILES | O=C(NC1CC1)c1ccc2noc(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C17H14N2O2/c20-17(18-13-7-8-13)12-6-9-15-14(10-12)16(21-19-15)11-4-2-1-3-5-11/h1-6,9-10,13H,7-8H2,(H,18,20) |
| InChIKey | YXXQLDFCEUVAJL-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |