C21H20N2O4 — CID 7503143
[2-(cyclopentylamino)-2-oxoethyl] 3-phenyl-2,1-benzoxazole-5-carboxylate (PubChem CID 7503143) has the molecular formula C21H20N2O4 and a molecular weight of 364.40 g/mol. Its IUPAC name is [2-(cyclopentylamino)-2-oxoethyl] 3-phenyl-2,1-benzoxazole-5-carboxylate.
| Compound Name | [2-(cyclopentylamino)-2-oxoethyl] 3-phenyl-2,1-benzoxazole-5-carboxylate |
|---|---|
| PubChem CID | 7503143 |
| Molecular Formula | C21H20N2O4 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | [2-(cyclopentylamino)-2-oxoethyl] 3-phenyl-2,1-benzoxazole-5-carboxylate |
| SMILES | O=C(COC(=O)c1ccc2noc(-c3ccccc3)c2c1)NC1CCCC1 |
| InChI | InChI=1S/C21H20N2O4/c24-19(22-16-8-4-5-9-16)13-26-21(25)15-10-11-18-17(12-15)20(27-23-18)14-6-2-1-3-7-14/h1-3,6-7,10-12,16H,4-5,8-9,13H2,(H,22,24) |
| InChIKey | DAKIPUUTCMKGII-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |