C26H21N3O3 — CID 23971722
[2-(cyclopropylamino)-2-oxoethyl] 2,3-diphenylquinoxaline-6-carboxylate (PubChem CID 23971722) has the molecular formula C26H21N3O3 and a molecular weight of 423.47 g/mol. Its IUPAC name is [2-(cyclopropylamino)-2-oxoethyl] 2,3-diphenylquinoxaline-6-carboxylate.
| Compound Name | [2-(cyclopropylamino)-2-oxoethyl] 2,3-diphenylquinoxaline-6-carboxylate |
|---|---|
| PubChem CID | 23971722 |
| Molecular Formula | C26H21N3O3 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | [2-(cyclopropylamino)-2-oxoethyl] 2,3-diphenylquinoxaline-6-carboxylate |
| SMILES | O=C(COC(=O)c1ccc2nc(-c3ccccc3)c(-c3ccccc3)nc2c1)NC1CC1 |
| InChI | InChI=1S/C26H21N3O3/c30-23(27-20-12-13-20)16-32-26(31)19-11-14-21-22(15-19)29-25(18-9-5-2-6-10-18)24(28-21)17-7-3-1-4-8-17/h1-11,14-15,20H,12-13,16H2,(H,27,30) |
| InChIKey | XUWMPZOGGNEUBZ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |