C21H19N3O3 — CID 2580715
[2-(cyclopropylamino)-2-oxoethyl] 1,3-diphenylpyrazole-4-carboxylate (PubChem CID 2580715) has the molecular formula C21H19N3O3 and a molecular weight of 361.40 g/mol. Its IUPAC name is [2-(cyclopropylamino)-2-oxoethyl] 1,3-diphenylpyrazole-4-carboxylate.
| Compound Name | [2-(cyclopropylamino)-2-oxoethyl] 1,3-diphenylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 2580715 |
| Molecular Formula | C21H19N3O3 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | [2-(cyclopropylamino)-2-oxoethyl] 1,3-diphenylpyrazole-4-carboxylate |
| SMILES | O=C(COC(=O)c1cn(-c2ccccc2)nc1-c1ccccc1)NC1CC1 |
| InChI | InChI=1S/C21H19N3O3/c25-19(22-16-11-12-16)14-27-21(26)18-13-24(17-9-5-2-6-10-17)23-20(18)15-7-3-1-4-8-15/h1-10,13,16H,11-12,14H2,(H,22,25) |
| InChIKey | BIVYCQMZQASLJI-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |