C24H25N3O4 — CID 2357802
[2-(cyclopentylamino)-2-oxoethyl] 3-(3-methoxyphenyl)-1-phenylpyrazole-4-carboxylate (PubChem CID 2357802) has the molecular formula C24H25N3O4 and a molecular weight of 419.48 g/mol. Its IUPAC name is [2-(cyclopentylamino)-2-oxoethyl] 3-(3-methoxyphenyl)-1-phenylpyrazole-4-carboxylate.
| Compound Name | [2-(cyclopentylamino)-2-oxoethyl] 3-(3-methoxyphenyl)-1-phenylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 2357802 |
| Molecular Formula | C24H25N3O4 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | [2-(cyclopentylamino)-2-oxoethyl] 3-(3-methoxyphenyl)-1-phenylpyrazole-4-carboxylate |
| SMILES | COc1cccc(-c2nn(-c3ccccc3)cc2C(=O)OCC(=O)NC2CCCC2)c1 |
| InChI | InChI=1S/C24H25N3O4/c1-30-20-13-7-8-17(14-20)23-21(15-27(26-23)19-11-3-2-4-12-19)24(29)31-16-22(28)25-18-9-5-6-10-18/h2-4,7-8,11-15,18H,5-6,9-10,16H2,1H3,(H,25,28) |
| InChIKey | XPVTWSUZXFGXLE-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |