C37H26N2O5 — CID 126188565
[2-[4-(4-methylbenzoyl)oxyphenyl]-2-oxoethyl] 2,3-diphenylquinoxaline-6-carboxylate (PubChem CID 126188565) has the molecular formula C37H26N2O5 and a molecular weight of 578.62 g/mol. Its IUPAC name is [2-[4-(4-methylbenzoyl)oxyphenyl]-2-oxoethyl] 2,3-diphenylquinoxaline-6-carboxylate.
| Compound Name | [2-[4-(4-methylbenzoyl)oxyphenyl]-2-oxoethyl] 2,3-diphenylquinoxaline-6-carboxylate |
|---|---|
| PubChem CID | 126188565 |
| Molecular Formula | C37H26N2O5 |
| Molecular Weight | 578.62 g/mol |
| Exact Mass | 578.18 |
| IUPAC Name | [2-[4-(4-methylbenzoyl)oxyphenyl]-2-oxoethyl] 2,3-diphenylquinoxaline-6-carboxylate |
| SMILES | Cc1ccc(C(=O)Oc2ccc(C(=O)COC(=O)c3ccc4nc(-c5ccccc5)c(-c5ccccc5)nc4c3)cc2)cc1 |
| InChI | InChI=1S/C37H26N2O5/c1-24-12-14-28(15-13-24)37(42)44-30-19-16-25(17-20-30)33(40)23-43-36(41)29-18-21-31-32(22-29)39-35(27-10-6-3-7-11-27)34(38-31)26-8-4-2-5-9-26/h2-22H,23H2,1H3 |
| InChIKey | KGCYQSZGTVGSFN-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 95.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.62 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|