C23H15N3O4 — CID 8536736
[2-(4-cyanoanilino)-2-oxoethyl] 3-phenyl-2,1-benzoxazole-5-carboxylate (PubChem CID 8536736) has the molecular formula C23H15N3O4 and a molecular weight of 397.39 g/mol. Its IUPAC name is [2-(4-cyanoanilino)-2-oxoethyl] 3-phenyl-2,1-benzoxazole-5-carboxylate.
| Compound Name | [2-(4-cyanoanilino)-2-oxoethyl] 3-phenyl-2,1-benzoxazole-5-carboxylate |
|---|---|
| PubChem CID | 8536736 |
| Molecular Formula | C23H15N3O4 |
| Molecular Weight | 397.39 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | [2-(4-cyanoanilino)-2-oxoethyl] 3-phenyl-2,1-benzoxazole-5-carboxylate |
| SMILES | N#Cc1ccc(NC(=O)COC(=O)c2ccc3noc(-c4ccccc4)c3c2)cc1 |
| InChI | InChI=1S/C23H15N3O4/c24-13-15-6-9-18(10-7-15)25-21(27)14-29-23(28)17-8-11-20-19(12-17)22(30-26-20)16-4-2-1-3-5-16/h1-12H,14H2,(H,25,27) |
| InChIKey | AAZVQGNDRWSIJT-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 105.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.39 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |