C17H12N2O2 — CID 18110112
3-phenyl-N-prop-2-ynyl-2,1-benzoxazole-5-carboxamide (PubChem CID 18110112) has the molecular formula C17H12N2O2 and a molecular weight of 276.30 g/mol. Its IUPAC name is 3-phenyl-N-prop-2-ynyl-2,1-benzoxazole-5-carboxamide.
| Compound Name | 3-phenyl-N-prop-2-ynyl-2,1-benzoxazole-5-carboxamide |
|---|---|
| PubChem CID | 18110112 |
| Molecular Formula | C17H12N2O2 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 3-phenyl-N-prop-2-ynyl-2,1-benzoxazole-5-carboxamide |
| SMILES | C#CCNC(=O)c1ccc2noc(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C17H12N2O2/c1-2-10-18-17(20)13-8-9-15-14(11-13)16(21-19-15)12-6-4-3-5-7-12/h1,3-9,11H,10H2,(H,18,20) |
| InChIKey | IWMUPPZRIJWJGS-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|