C25H23N3O3 — CID 9193125
N-[4-(diethylcarbamoyl)phenyl]-3-phenyl-2,1-benzoxazole-5-carboxamide (PubChem CID 9193125) has the molecular formula C25H23N3O3 and a molecular weight of 413.48 g/mol. Its IUPAC name is N-[4-(diethylcarbamoyl)phenyl]-3-phenyl-2,1-benzoxazole-5-carboxamide.
| Compound Name | N-[4-(diethylcarbamoyl)phenyl]-3-phenyl-2,1-benzoxazole-5-carboxamide |
|---|---|
| PubChem CID | 9193125 |
| Molecular Formula | C25H23N3O3 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | N-[4-(diethylcarbamoyl)phenyl]-3-phenyl-2,1-benzoxazole-5-carboxamide |
| SMILES | CCN(CC)C(=O)c1ccc(NC(=O)c2ccc3noc(-c4ccccc4)c3c2)cc1 |
| InChI | InChI=1S/C25H23N3O3/c1-3-28(4-2)25(30)18-10-13-20(14-11-18)26-24(29)19-12-15-22-21(16-19)23(31-27-22)17-8-6-5-7-9-17/h5-16H,3-4H2,1-2H3,(H,26,29) |
| InChIKey | SAAFTFCTQAOVIU-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |