C19H13N3O3S — CID 9318764
3-phenyl-N'-(thiophene-2-carbonyl)-2,1-benzoxazole-5-carbohydrazide (PubChem CID 9318764) has the molecular formula C19H13N3O3S and a molecular weight of 363.40 g/mol. Its IUPAC name is 3-phenyl-N'-(thiophene-2-carbonyl)-2,1-benzoxazole-5-carbohydrazide.
| Compound Name | 3-phenyl-N'-(thiophene-2-carbonyl)-2,1-benzoxazole-5-carbohydrazide |
|---|---|
| PubChem CID | 9318764 |
| Molecular Formula | C19H13N3O3S |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | 3-phenyl-N'-(thiophene-2-carbonyl)-2,1-benzoxazole-5-carbohydrazide |
| SMILES | O=C(NNC(=O)c1cccs1)c1ccc2noc(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C19H13N3O3S/c23-18(20-21-19(24)16-7-4-10-26-16)13-8-9-15-14(11-13)17(25-22-15)12-5-2-1-3-6-12/h1-11H,(H,20,23)(H,21,24) |
| InChIKey | YXDOVAAUNHVUML-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|