C20H14N4O3 — CID 9033671
3-phenyl-N'-(pyridine-2-carbonyl)-2,1-benzoxazole-5-carbohydrazide (PubChem CID 9033671) has the molecular formula C20H14N4O3 and a molecular weight of 358.36 g/mol. Its IUPAC name is 3-phenyl-N'-(pyridine-2-carbonyl)-2,1-benzoxazole-5-carbohydrazide.
| Compound Name | 3-phenyl-N'-(pyridine-2-carbonyl)-2,1-benzoxazole-5-carbohydrazide |
|---|---|
| PubChem CID | 9033671 |
| Molecular Formula | C20H14N4O3 |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 3-phenyl-N'-(pyridine-2-carbonyl)-2,1-benzoxazole-5-carbohydrazide |
| SMILES | O=C(NNC(=O)c1ccccn1)c1ccc2noc(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C20H14N4O3/c25-19(22-23-20(26)17-8-4-5-11-21-17)14-9-10-16-15(12-14)18(27-24-16)13-6-2-1-3-7-13/h1-12H,(H,22,25)(H,23,26) |
| InChIKey | XUOXVTSJIMBQNO-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|