C21H17N3O4 — CID 9277216
N'-(2,5-dimethylfuran-3-carbonyl)-3-phenyl-2,1-benzoxazole-5-carbohydrazide (PubChem CID 9277216) has the molecular formula C21H17N3O4 and a molecular weight of 375.38 g/mol. Its IUPAC name is N'-(2,5-dimethylfuran-3-carbonyl)-3-phenyl-2,1-benzoxazole-5-carbohydrazide.
| Compound Name | N'-(2,5-dimethylfuran-3-carbonyl)-3-phenyl-2,1-benzoxazole-5-carbohydrazide |
|---|---|
| PubChem CID | 9277216 |
| Molecular Formula | C21H17N3O4 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | N'-(2,5-dimethylfuran-3-carbonyl)-3-phenyl-2,1-benzoxazole-5-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNC(=O)c2ccc3noc(-c4ccccc4)c3c2)c(C)o1 |
| InChI | InChI=1S/C21H17N3O4/c1-12-10-16(13(2)27-12)21(26)23-22-20(25)15-8-9-18-17(11-15)19(28-24-18)14-6-4-3-5-7-14/h3-11H,1-2H3,(H,22,25)(H,23,26) |
| InChIKey | QDYQTFVZHRJOFX-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 97.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|