C23H21N3O2 — CID 71895533
N-[4-(dimethylamino)-2-methylphenyl]-3-phenyl-2,1-benzoxazole-5-carboxamide (PubChem CID 71895533) has the molecular formula C23H21N3O2 and a molecular weight of 371.44 g/mol. Its IUPAC name is N-[4-(dimethylamino)-2-methylphenyl]-3-phenyl-2,1-benzoxazole-5-carboxamide.
| Compound Name | N-[4-(dimethylamino)-2-methylphenyl]-3-phenyl-2,1-benzoxazole-5-carboxamide |
|---|---|
| PubChem CID | 71895533 |
| Molecular Formula | C23H21N3O2 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | N-[4-(dimethylamino)-2-methylphenyl]-3-phenyl-2,1-benzoxazole-5-carboxamide |
| SMILES | Cc1cc(N(C)C)ccc1NC(=O)c1ccc2noc(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C23H21N3O2/c1-15-13-18(26(2)3)10-12-20(15)24-23(27)17-9-11-21-19(14-17)22(28-25-21)16-7-5-4-6-8-16/h4-14H,1-3H3,(H,24,27) |
| InChIKey | DMLHYWKSYGLMPN-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|