C16H11F3N2O5 — CID 7504406
[(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 4-nitrobenzoate (PubChem CID 7504406) has the molecular formula C16H11F3N2O5 and a molecular weight of 368.27 g/mol. Its IUPAC name is [(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 4-nitrobenzoate.
| Compound Name | [(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 7504406 |
| Molecular Formula | C16H11F3N2O5 |
| Molecular Weight | 368.27 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | [(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 4-nitrobenzoate |
| SMILES | C[C@@H](OC(=O)c1ccc([N+](=O)[O-])cc1)C(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C16H11F3N2O5/c1-8(15(22)20-12-7-6-11(17)13(18)14(12)19)26-16(23)9-2-4-10(5-3-9)21(24)25/h2-8H,1H3,(H,20,22)/t8-/m1/s1 |
| InChIKey | NDLVCOYZRVRAMZ-MRVPVSSYSA-N |
| XLogP | 3.20 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.27 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|