C17H13F3N2O6 — CID 7770202
[(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 2-(4-nitrophenoxy)acetate (PubChem CID 7770202) has the molecular formula C17H13F3N2O6 and a molecular weight of 398.29 g/mol. Its IUPAC name is [(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 2-(4-nitrophenoxy)acetate.
| Compound Name | [(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 2-(4-nitrophenoxy)acetate |
|---|---|
| PubChem CID | 7770202 |
| Molecular Formula | C17H13F3N2O6 |
| Molecular Weight | 398.29 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | [(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 2-(4-nitrophenoxy)acetate |
| SMILES | C[C@@H](OC(=O)COc1ccc([N+](=O)[O-])cc1)C(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C17H13F3N2O6/c1-9(17(24)21-13-7-6-12(18)15(19)16(13)20)28-14(23)8-27-11-4-2-10(3-5-11)22(25)26/h2-7,9H,8H2,1H3,(H,21,24)/t9-/m1/s1 |
| InChIKey | YCQHWNQHAURHIY-SECBINFHSA-N |
| XLogP | 2.96 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.29 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|