C16H12F3N3O5 — CID 18100383
[1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 2-amino-4-nitrobenzoate (PubChem CID 18100383) has the molecular formula C16H12F3N3O5 and a molecular weight of 383.28 g/mol. Its IUPAC name is [1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 2-amino-4-nitrobenzoate.
| Compound Name | [1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 2-amino-4-nitrobenzoate |
|---|---|
| PubChem CID | 18100383 |
| Molecular Formula | C16H12F3N3O5 |
| Molecular Weight | 383.28 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | [1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 2-amino-4-nitrobenzoate |
| SMILES | CC(OC(=O)c1ccc([N+](=O)[O-])cc1N)C(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C16H12F3N3O5/c1-7(15(23)21-12-5-4-10(17)13(18)14(12)19)27-16(24)9-3-2-8(22(25)26)6-11(9)20/h2-7H,20H2,1H3,(H,21,23) |
| InChIKey | QMSIOPFFRYWICP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.28 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|