C18H17N3O7 — CID 8954475
[(2R)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] 2-(4-nitrophenoxy)acetate (PubChem CID 8954475) has the molecular formula C18H17N3O7 and a molecular weight of 387.35 g/mol. Its IUPAC name is [(2R)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] 2-(4-nitrophenoxy)acetate.
| Compound Name | [(2R)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] 2-(4-nitrophenoxy)acetate |
|---|---|
| PubChem CID | 8954475 |
| Molecular Formula | C18H17N3O7 |
| Molecular Weight | 387.35 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | [(2R)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] 2-(4-nitrophenoxy)acetate |
| SMILES | C[C@@H](OC(=O)COc1ccc([N+](=O)[O-])cc1)C(=O)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H17N3O7/c1-12(17(23)19-20-18(24)13-5-3-2-4-6-13)28-16(22)11-27-15-9-7-14(8-10-15)21(25)26/h2-10,12H,11H2,1H3,(H,19,23)(H,20,24)/t12-/m1/s1 |
| InChIKey | GQBARLKOEKVTNK-GFCCVEGCSA-N |
| XLogP | 1.37 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.35 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|