C19H20N2O6 — CID 8940523
[(2R)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] 2-(2-methoxyphenoxy)acetate (PubChem CID 8940523) has the molecular formula C19H20N2O6 and a molecular weight of 372.38 g/mol. Its IUPAC name is [(2R)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] 2-(2-methoxyphenoxy)acetate.
| Compound Name | [(2R)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] 2-(2-methoxyphenoxy)acetate |
|---|---|
| PubChem CID | 8940523 |
| Molecular Formula | C19H20N2O6 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | [(2R)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] 2-(2-methoxyphenoxy)acetate |
| SMILES | COc1ccccc1OCC(=O)O[C@H](C)C(=O)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H20N2O6/c1-13(18(23)20-21-19(24)14-8-4-3-5-9-14)27-17(22)12-26-16-11-7-6-10-15(16)25-2/h3-11,13H,12H2,1-2H3,(H,20,23)(H,21,24)/t13-/m1/s1 |
| InChIKey | QFTIWTUEDQMWTG-CYBMUJFWSA-N |
| XLogP | 1.47 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|