C18H16ClFN2O5 — CID 9060339
[(2R)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] 2-(2-chloro-4-fluorophenoxy)acetate (PubChem CID 9060339) has the molecular formula C18H16ClFN2O5 and a molecular weight of 394.79 g/mol. Its IUPAC name is [(2R)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] 2-(2-chloro-4-fluorophenoxy)acetate.
| Compound Name | [(2R)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] 2-(2-chloro-4-fluorophenoxy)acetate |
|---|---|
| PubChem CID | 9060339 |
| Molecular Formula | C18H16ClFN2O5 |
| Molecular Weight | 394.79 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | [(2R)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] 2-(2-chloro-4-fluorophenoxy)acetate |
| SMILES | C[C@@H](OC(=O)COc1ccc(F)cc1Cl)C(=O)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H16ClFN2O5/c1-11(17(24)21-22-18(25)12-5-3-2-4-6-12)27-16(23)10-26-15-8-7-13(20)9-14(15)19/h2-9,11H,10H2,1H3,(H,21,24)(H,22,25)/t11-/m1/s1 |
| InChIKey | YABZXXACSGWGQM-LLVKDONJSA-N |
| XLogP | 2.25 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.79 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|