C19H20ClFN2O5 — CID 9428468
(2R)-N'-[2-(2-chloro-4-fluorophenoxy)acetyl]-2-(4-ethoxyphenoxy)propanehydrazide (PubChem CID 9428468) has the molecular formula C19H20ClFN2O5 and a molecular weight of 410.83 g/mol. Its IUPAC name is (2R)-N'-[2-(2-chloro-4-fluorophenoxy)acetyl]-2-(4-ethoxyphenoxy)propanehydrazide.
| Compound Name | (2R)-N'-[2-(2-chloro-4-fluorophenoxy)acetyl]-2-(4-ethoxyphenoxy)propanehydrazide |
|---|---|
| PubChem CID | 9428468 |
| Molecular Formula | C19H20ClFN2O5 |
| Molecular Weight | 410.83 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | (2R)-N'-[2-(2-chloro-4-fluorophenoxy)acetyl]-2-(4-ethoxyphenoxy)propanehydrazide |
| SMILES | CCOc1ccc(O[C@H](C)C(=O)NNC(=O)COc2ccc(F)cc2Cl)cc1 |
| InChI | InChI=1S/C19H20ClFN2O5/c1-3-26-14-5-7-15(8-6-14)28-12(2)19(25)23-22-18(24)11-27-17-9-4-13(21)10-16(17)20/h4-10,12H,3,11H2,1-2H3,(H,22,24)(H,23,25)/t12-/m1/s1 |
| InChIKey | PDMFTJWRADULAQ-GFCCVEGCSA-N |
| XLogP | 2.87 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.83 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|