C19H21ClN2O5 — CID 9343185
(2S)-N'-[2-(3-chlorophenoxy)acetyl]-2-(4-ethoxyphenoxy)propanehydrazide (PubChem CID 9343185) has the molecular formula C19H21ClN2O5 and a molecular weight of 392.84 g/mol. Its IUPAC name is (2S)-N'-[2-(3-chlorophenoxy)acetyl]-2-(4-ethoxyphenoxy)propanehydrazide.
| Compound Name | (2S)-N'-[2-(3-chlorophenoxy)acetyl]-2-(4-ethoxyphenoxy)propanehydrazide |
|---|---|
| PubChem CID | 9343185 |
| Molecular Formula | C19H21ClN2O5 |
| Molecular Weight | 392.84 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | (2S)-N'-[2-(3-chlorophenoxy)acetyl]-2-(4-ethoxyphenoxy)propanehydrazide |
| SMILES | CCOc1ccc(O[C@@H](C)C(=O)NNC(=O)COc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C19H21ClN2O5/c1-3-25-15-7-9-16(10-8-15)27-13(2)19(24)22-21-18(23)12-26-17-6-4-5-14(20)11-17/h4-11,13H,3,12H2,1-2H3,(H,21,23)(H,22,24)/t13-/m0/s1 |
| InChIKey | WHVZVVLBMAZNEB-ZDUSSCGKSA-N |
| XLogP | 2.73 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.84 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|