C21H26N2O5 — CID 43003788
N'-[2-(4-ethoxyphenoxy)propanoyl]-4-phenoxybutanehydrazide (PubChem CID 43003788) has the molecular formula C21H26N2O5 and a molecular weight of 386.45 g/mol. Its IUPAC name is N'-[2-(4-ethoxyphenoxy)propanoyl]-4-phenoxybutanehydrazide.
| Compound Name | N'-[2-(4-ethoxyphenoxy)propanoyl]-4-phenoxybutanehydrazide |
|---|---|
| PubChem CID | 43003788 |
| Molecular Formula | C21H26N2O5 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | N'-[2-(4-ethoxyphenoxy)propanoyl]-4-phenoxybutanehydrazide |
| SMILES | CCOc1ccc(OC(C)C(=O)NNC(=O)CCCOc2ccccc2)cc1 |
| InChI | InChI=1S/C21H26N2O5/c1-3-26-18-11-13-19(14-12-18)28-16(2)21(25)23-22-20(24)10-7-15-27-17-8-5-4-6-9-17/h4-6,8-9,11-14,16H,3,7,10,15H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | ULRKVOGECVJWFR-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|