C22H35N3O5 — CID 56546251
5-[2-[2-(4-ethoxyphenoxy)propanoyl]hydrazinyl]-5-oxo-N,N-dipropylpentanamide (PubChem CID 56546251) has the molecular formula C22H35N3O5 and a molecular weight of 421.54 g/mol. Its IUPAC name is 5-[2-[2-(4-ethoxyphenoxy)propanoyl]hydrazinyl]-5-oxo-N,N-dipropylpentanamide.
| Compound Name | 5-[2-[2-(4-ethoxyphenoxy)propanoyl]hydrazinyl]-5-oxo-N,N-dipropylpentanamide |
|---|---|
| PubChem CID | 56546251 |
| Molecular Formula | C22H35N3O5 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.26 |
| IUPAC Name | 5-[2-[2-(4-ethoxyphenoxy)propanoyl]hydrazinyl]-5-oxo-N,N-dipropylpentanamide |
| SMILES | CCCN(CCC)C(=O)CCCC(=O)NNC(=O)C(C)Oc1ccc(OCC)cc1 |
| InChI | InChI=1S/C22H35N3O5/c1-5-15-25(16-6-2)21(27)10-8-9-20(26)23-24-22(28)17(4)30-19-13-11-18(12-14-19)29-7-3/h11-14,17H,5-10,15-16H2,1-4H3,(H,23,26)(H,24,28) |
| InChIKey | YGFICBHHPSCBNZ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|