C17H26N2O4S — CID 43060076
N'-(2-butylsulfanylacetyl)-2-(4-ethoxyphenoxy)propanehydrazide (PubChem CID 43060076) has the molecular formula C17H26N2O4S and a molecular weight of 354.47 g/mol. Its IUPAC name is N'-(2-butylsulfanylacetyl)-2-(4-ethoxyphenoxy)propanehydrazide.
| Compound Name | N'-(2-butylsulfanylacetyl)-2-(4-ethoxyphenoxy)propanehydrazide |
|---|---|
| PubChem CID | 43060076 |
| Molecular Formula | C17H26N2O4S |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | N'-(2-butylsulfanylacetyl)-2-(4-ethoxyphenoxy)propanehydrazide |
| SMILES | CCCCSCC(=O)NNC(=O)C(C)Oc1ccc(OCC)cc1 |
| InChI | InChI=1S/C17H26N2O4S/c1-4-6-11-24-12-16(20)18-19-17(21)13(3)23-15-9-7-14(8-10-15)22-5-2/h7-10,13H,4-6,11-12H2,1-3H3,(H,18,20)(H,19,21) |
| InChIKey | IPGSWKZKLWHWJJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|