C22H32N4O4 — CID 9088700
(2S)-N'-[2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetyl]-2-(4-ethoxyphenoxy)propanehydrazide (PubChem CID 9088700) has the molecular formula C22H32N4O4 and a molecular weight of 416.52 g/mol. Its IUPAC name is (2S)-N'-[2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetyl]-2-(4-ethoxyphenoxy)propanehydrazide.
| Compound Name | (2S)-N'-[2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetyl]-2-(4-ethoxyphenoxy)propanehydrazide |
|---|---|
| PubChem CID | 9088700 |
| Molecular Formula | C22H32N4O4 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | (2S)-N'-[2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetyl]-2-(4-ethoxyphenoxy)propanehydrazide |
| SMILES | CCOc1ccc(O[C@@H](C)C(=O)NNC(=O)Cc2c(C)nn(CC(C)C)c2C)cc1 |
| InChI | InChI=1S/C22H32N4O4/c1-7-29-18-8-10-19(11-9-18)30-17(6)22(28)24-23-21(27)12-20-15(4)25-26(16(20)5)13-14(2)3/h8-11,14,17H,7,12-13H2,1-6H3,(H,23,27)(H,24,28)/t17-/m0/s1 |
| InChIKey | PTOBTXCEXXBFDN-KRWDZBQOSA-N |
| XLogP | 2.71 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|