C20H27BrN4O3 — CID 46656899
2-(3-bromophenoxy)-N'-[2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetyl]propanehydrazide (PubChem CID 46656899) has the molecular formula C20H27BrN4O3 and a molecular weight of 451.37 g/mol. Its IUPAC name is 2-(3-bromophenoxy)-N'-[2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetyl]propanehydrazide.
| Compound Name | 2-(3-bromophenoxy)-N'-[2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetyl]propanehydrazide |
|---|---|
| PubChem CID | 46656899 |
| Molecular Formula | C20H27BrN4O3 |
| Molecular Weight | 451.37 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | 2-(3-bromophenoxy)-N'-[2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetyl]propanehydrazide |
| SMILES | Cc1nn(CC(C)C)c(C)c1CC(=O)NNC(=O)C(C)Oc1cccc(Br)c1 |
| InChI | InChI=1S/C20H27BrN4O3/c1-12(2)11-25-14(4)18(13(3)24-25)10-19(26)22-23-20(27)15(5)28-17-8-6-7-16(21)9-17/h6-9,12,15H,10-11H2,1-5H3,(H,22,26)(H,23,27) |
| InChIKey | DJZBWHKIXWVNGE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.37 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|