C12H15BrN2O3S — CID 9370776
(2R)-2-(3-bromophenoxy)-N'-(2-methylsulfanylacetyl)propanehydrazide (PubChem CID 9370776) has the molecular formula C12H15BrN2O3S and a molecular weight of 347.23 g/mol. Its IUPAC name is (2R)-2-(3-bromophenoxy)-N'-(2-methylsulfanylacetyl)propanehydrazide.
| Compound Name | (2R)-2-(3-bromophenoxy)-N'-(2-methylsulfanylacetyl)propanehydrazide |
|---|---|
| PubChem CID | 9370776 |
| Molecular Formula | C12H15BrN2O3S |
| Molecular Weight | 347.23 g/mol |
| Exact Mass | 346.00 |
| IUPAC Name | (2R)-2-(3-bromophenoxy)-N'-(2-methylsulfanylacetyl)propanehydrazide |
| SMILES | CSCC(=O)NNC(=O)[C@@H](C)Oc1cccc(Br)c1 |
| InChI | InChI=1S/C12H15BrN2O3S/c1-8(12(17)15-14-11(16)7-19-2)18-10-5-3-4-9(13)6-10/h3-6,8H,7H2,1-2H3,(H,14,16)(H,15,17)/t8-/m1/s1 |
| InChIKey | ICTMBXRZBHWPLX-MRVPVSSYSA-N |
| XLogP | 1.73 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.23 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|