C17H16BrFN2O3 — CID 9371318
(2R)-2-(3-bromophenoxy)-N'-[2-(3-fluorophenyl)acetyl]propanehydrazide (PubChem CID 9371318) has the molecular formula C17H16BrFN2O3 and a molecular weight of 395.23 g/mol. Its IUPAC name is (2R)-2-(3-bromophenoxy)-N'-[2-(3-fluorophenyl)acetyl]propanehydrazide.
| Compound Name | (2R)-2-(3-bromophenoxy)-N'-[2-(3-fluorophenyl)acetyl]propanehydrazide |
|---|---|
| PubChem CID | 9371318 |
| Molecular Formula | C17H16BrFN2O3 |
| Molecular Weight | 395.23 g/mol |
| Exact Mass | 394.03 |
| IUPAC Name | (2R)-2-(3-bromophenoxy)-N'-[2-(3-fluorophenyl)acetyl]propanehydrazide |
| SMILES | C[C@@H](Oc1cccc(Br)c1)C(=O)NNC(=O)Cc1cccc(F)c1 |
| InChI | InChI=1S/C17H16BrFN2O3/c1-11(24-15-7-3-5-13(18)10-15)17(23)21-20-16(22)9-12-4-2-6-14(19)8-12/h2-8,10-11H,9H2,1H3,(H,20,22)(H,21,23)/t11-/m1/s1 |
| InChIKey | GQAIGSOXPMAJQI-LLVKDONJSA-N |
| XLogP | 2.75 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.23 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|