C16H16BrN3O5 — CID 9370870
N-[2-[2-[(2R)-2-(3-bromophenoxy)propanoyl]hydrazinyl]-2-oxoethyl]furan-2-carboxamide (PubChem CID 9370870) has the molecular formula C16H16BrN3O5 and a molecular weight of 410.22 g/mol. Its IUPAC name is N-[2-[2-[(2R)-2-(3-bromophenoxy)propanoyl]hydrazinyl]-2-oxoethyl]furan-2-carboxamide.
| Compound Name | N-[2-[2-[(2R)-2-(3-bromophenoxy)propanoyl]hydrazinyl]-2-oxoethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 9370870 |
| Molecular Formula | C16H16BrN3O5 |
| Molecular Weight | 410.22 g/mol |
| Exact Mass | 409.03 |
| IUPAC Name | N-[2-[2-[(2R)-2-(3-bromophenoxy)propanoyl]hydrazinyl]-2-oxoethyl]furan-2-carboxamide |
| SMILES | C[C@@H](Oc1cccc(Br)c1)C(=O)NNC(=O)CNC(=O)c1ccco1 |
| InChI | InChI=1S/C16H16BrN3O5/c1-10(25-12-5-2-4-11(17)8-12)15(22)20-19-14(21)9-18-16(23)13-6-3-7-24-13/h2-8,10H,9H2,1H3,(H,18,23)(H,19,21)(H,20,22)/t10-/m1/s1 |
| InChIKey | LODDAHCJJZUEPL-SNVBAGLBSA-N |
| XLogP | 1.39 |
| TPSA | 109.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.22 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|