C15H16BrN3O3S — CID 8770692
1-[[(2S)-2-(3-bromophenoxy)propanoyl]amino]-3-(furan-2-ylmethyl)thiourea (PubChem CID 8770692) has the molecular formula C15H16BrN3O3S and a molecular weight of 398.28 g/mol. Its IUPAC name is 1-[[(2S)-2-(3-bromophenoxy)propanoyl]amino]-3-(furan-2-ylmethyl)thiourea.
| Compound Name | 1-[[(2S)-2-(3-bromophenoxy)propanoyl]amino]-3-(furan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 8770692 |
| Molecular Formula | C15H16BrN3O3S |
| Molecular Weight | 398.28 g/mol |
| Exact Mass | 397.01 |
| IUPAC Name | 1-[[(2S)-2-(3-bromophenoxy)propanoyl]amino]-3-(furan-2-ylmethyl)thiourea |
| SMILES | C[C@H](Oc1cccc(Br)c1)C(=O)NNC(=S)NCc1ccco1 |
| InChI | InChI=1S/C15H16BrN3O3S/c1-10(22-12-5-2-4-11(16)8-12)14(20)18-19-15(23)17-9-13-6-3-7-21-13/h2-8,10H,9H2,1H3,(H,18,20)(H2,17,19,23)/t10-/m0/s1 |
| InChIKey | ULPRDGSNYMSYSA-JTQLQIEISA-N |
| XLogP | 2.50 |
| TPSA | 75.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.28 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|