C16H17BrN2O3S — CID 17052012
5-bromo-N-(furan-2-ylmethylcarbamothioyl)-2-propan-2-yloxybenzamide (PubChem CID 17052012) has the molecular formula C16H17BrN2O3S and a molecular weight of 397.29 g/mol. Its IUPAC name is 5-bromo-N-(furan-2-ylmethylcarbamothioyl)-2-propan-2-yloxybenzamide.
| Compound Name | 5-bromo-N-(furan-2-ylmethylcarbamothioyl)-2-propan-2-yloxybenzamide |
|---|---|
| PubChem CID | 17052012 |
| Molecular Formula | C16H17BrN2O3S |
| Molecular Weight | 397.29 g/mol |
| Exact Mass | 396.01 |
| IUPAC Name | 5-bromo-N-(furan-2-ylmethylcarbamothioyl)-2-propan-2-yloxybenzamide |
| SMILES | CC(C)Oc1ccc(Br)cc1C(=O)NC(=S)NCc1ccco1 |
| InChI | InChI=1S/C16H17BrN2O3S/c1-10(2)22-14-6-5-11(17)8-13(14)15(20)19-16(23)18-9-12-4-3-7-21-12/h3-8,10H,9H2,1-2H3,(H2,18,19,20,23) |
| InChIKey | IWEKYQPOWIGTRG-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 63.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.29 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|