C17H20BrFN2O2 — CID 55413339
(4-bromo-2-fluorophenyl) 2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetate (PubChem CID 55413339) has the molecular formula C17H20BrFN2O2 and a molecular weight of 383.26 g/mol. Its IUPAC name is (4-bromo-2-fluorophenyl) 2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetate.
| Compound Name | (4-bromo-2-fluorophenyl) 2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetate |
|---|---|
| PubChem CID | 55413339 |
| Molecular Formula | C17H20BrFN2O2 |
| Molecular Weight | 383.26 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | (4-bromo-2-fluorophenyl) 2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetate |
| SMILES | Cc1nn(CC(C)C)c(C)c1CC(=O)Oc1ccc(Br)cc1F |
| InChI | InChI=1S/C17H20BrFN2O2/c1-10(2)9-21-12(4)14(11(3)20-21)8-17(22)23-16-6-5-13(18)7-15(16)19/h5-7,10H,8-9H2,1-4H3 |
| InChIKey | OTXWBTUYWVDGBK-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.26 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|